C40H50N5O7PSi — CID 59637401
N-[bis(4-methoxyphenyl)-phenylmethyl]-9-[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-2-dimethoxyphosphorylethenyl]oxolan-2-yl]purin-6-amine (PubChem CID 59637401) has the molecular formula C40H50N5O7PSi and a molecular weight of 771.93 g/mol. Its IUPAC name is N-[bis(4-methoxyphenyl)-phenylmethyl]-9-[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-2-dimethoxyphosphorylethenyl]oxolan-2-yl]purin-6-amine.
| Compound Name | N-[bis(4-methoxyphenyl)-phenylmethyl]-9-[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-2-dimethoxyphosphorylethenyl]oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 59637401 |
| Molecular Formula | C40H50N5O7PSi |
| Molecular Weight | 771.93 g/mol |
| Exact Mass | 771.32 |
| IUPAC Name | N-[bis(4-methoxyphenyl)-phenylmethyl]-9-[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-2-dimethoxyphosphorylethenyl]oxolan-2-yl]purin-6-amine |
| SMILES | COc1ccc(C(Nc2ncnc3c2ncn3[C@@H]2O[C@H](/C=C/P(=O)(OC)OC)C[C@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H50N5O7PSi/c1-39(2,3)54(8,9)52-34-25-33(23-24-53(46,49-6)50-7)51-38(34)45-27-43-35-36(41-26-42-37(35)45)44-40(28-13-11-10-12-14-28,29-15-19-31(47-4)20-16-29)30-17-21-32(48-5)22-18-30/h10-24,26-27,33-34,38H,25H2,1-9H3,(H,41,42,44)/b24-23+/t33-,34-,38-/m1/s1 |
| InChIKey | XJIWIJSZWFSOKU-XYJJGPOWSA-N |
| XLogP | 8.93 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.93 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|