C51H48N6O5 — CID 21145695
(2R,3S,5R)-2-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]-5-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-(methylamino)oxolan-3-ol (PubChem CID 21145695) has the molecular formula C51H48N6O5 and a molecular weight of 824.98 g/mol. Its IUPAC name is (2R,3S,5R)-2-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]-5-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-(methylamino)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]-5-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-(methylamino)oxolan-3-ol |
|---|---|
| PubChem CID | 21145695 |
| Molecular Formula | C51H48N6O5 |
| Molecular Weight | 824.98 g/mol |
| Exact Mass | 824.37 |
| IUPAC Name | (2R,3S,5R)-2-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]-5-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-(methylamino)oxolan-3-ol |
| SMILES | CNC1[C@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)ncnc32)O[C@H](C(O)C(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)[C@H]1O |
| InChI | InChI=1S/C51H48N6O5/c1-52-42-44(58)45(46(59)50(34-16-8-4-9-17-34,35-18-10-5-11-19-35)36-24-28-40(60-2)29-25-36)62-49(42)57-33-55-43-47(53-32-54-48(43)57)56-51(37-20-12-6-13-21-37,38-22-14-7-15-23-38)39-26-30-41(61-3)31-27-39/h4-33,42,44-46,49,52,58-59H,1-3H3,(H,53,54,56)/t42?,44-,45-,46?,49+/m0/s1 |
| InChIKey | QCQXOINIHBRJMO-SROWGVCUSA-N |
| XLogP | 7.49 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.98 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|