C38H36FN5O3 — CID 159359412
9-[(2R,4S,5R)-5-ethyl-4-fluoro-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-N-tritylpurin-6-amine (PubChem CID 159359412) has the molecular formula C38H36FN5O3 and a molecular weight of 629.74 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-5-ethyl-4-fluoro-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-N-tritylpurin-6-amine.
| Compound Name | 9-[(2R,4S,5R)-5-ethyl-4-fluoro-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-N-tritylpurin-6-amine |
|---|---|
| PubChem CID | 159359412 |
| Molecular Formula | C38H36FN5O3 |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | 9-[(2R,4S,5R)-5-ethyl-4-fluoro-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]-N-tritylpurin-6-amine |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NC(c4ccccc4)(c4ccccc4)c4ccccc4)ncnc32)C(OCc2ccc(OC)cc2)[C@H]1F |
| InChI | InChI=1S/C38H36FN5O3/c1-3-31-32(39)34(46-23-26-19-21-30(45-2)22-20-26)37(47-31)44-25-42-33-35(40-24-41-36(33)44)43-38(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22,24-25,31-32,34,37H,3,23H2,1-2H3,(H,40,41,43)/t31-,32+,34?,37-/m1/s1 |
| InChIKey | MWUNHSNIJOWVNJ-KKZOWCHDSA-N |
| XLogP | 7.47 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|