C60H56N5O11P — CID 10898411
[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[(4-methoxyphenyl)methoxy]oxolan-3-yl] dibenzyl phosphate (PubChem CID 10898411) has the molecular formula C60H56N5O11P and a molecular weight of 1054.11 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[(4-methoxyphenyl)methoxy]oxolan-3-yl] dibenzyl phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[(4-methoxyphenyl)methoxy]oxolan-3-yl] dibenzyl phosphate |
|---|---|
| PubChem CID | 10898411 |
| Molecular Formula | C60H56N5O11P |
| Molecular Weight | 1054.11 g/mol |
| Exact Mass | 1053.37 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[(4-methoxyphenyl)methoxy]oxolan-3-yl] dibenzyl phosphate |
| SMILES | COc1ccc(CO[C@@H]2[C@H](OP(=O)(OCc3ccccc3)OCc3ccccc3)[C@@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O[C@H]2n2cnc3c(NC(=O)c4ccccc4)ncnc32)cc1 |
| InChI | InChI=1S/C60H56N5O11P/c1-68-49-30-24-44(25-31-49)36-71-55-54(76-77(67,73-37-42-16-8-4-9-17-42)74-38-43-18-10-5-11-19-43)52(75-59(55)65-41-63-53-56(61-40-62-57(53)65)64-58(66)45-20-12-6-13-21-45)39-72-60(46-22-14-7-15-23-46,47-26-32-50(69-2)33-27-47)48-28-34-51(70-3)35-29-48/h4-35,40-41,52,54-55,59H,36-39H2,1-3H3,(H,61,62,64,66)/t52-,54-,55-,59-/m1/s1 |
| InChIKey | SPGDMKQCDULHDI-IKGFSGJXSA-N |
| XLogP | 11.52 |
| TPSA | 172.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.11 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|