C41H43N5O6Si — CID 102410891
N-[9-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 102410891) has the molecular formula C41H43N5O6Si and a molecular weight of 729.91 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 102410891 |
| Molecular Formula | C41H43N5O6Si |
| Molecular Weight | 729.91 g/mol |
| Exact Mass | 729.30 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(CO[C@@H]2[C@H](O)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O[C@H]2n2cnc3c(NC(=O)c4ccccc4)ncnc32)cc1 |
| InChI | InChI=1S/C41H43N5O6Si/c1-41(2,3)53(31-16-10-6-11-17-31,32-18-12-7-13-19-32)51-25-33-35(47)36(50-24-28-20-22-30(49-4)23-21-28)40(52-33)46-27-44-34-37(42-26-43-38(34)46)45-39(48)29-14-8-5-9-15-29/h5-23,26-27,33,35-36,40,47H,24-25H2,1-4H3,(H,42,43,45,48)/t33-,35-,36-,40-/m1/s1 |
| InChIKey | YCUPTCUTLQTZSH-MUMPVVMASA-N |
| XLogP | 5.51 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.91 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|