C33H32N6O9S — CID 158528747
(4-nitrophenyl) 2-[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-[(4-methoxyphenyl)methoxy]-3-methyloxolan-2-yl]ethanesulfonate (PubChem CID 158528747) has the molecular formula C33H32N6O9S and a molecular weight of 688.72 g/mol. Its IUPAC name is (4-nitrophenyl) 2-[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-[(4-methoxyphenyl)methoxy]-3-methyloxolan-2-yl]ethanesulfonate.
| Compound Name | (4-nitrophenyl) 2-[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-[(4-methoxyphenyl)methoxy]-3-methyloxolan-2-yl]ethanesulfonate |
|---|---|
| PubChem CID | 158528747 |
| Molecular Formula | C33H32N6O9S |
| Molecular Weight | 688.72 g/mol |
| Exact Mass | 688.20 |
| IUPAC Name | (4-nitrophenyl) 2-[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-[(4-methoxyphenyl)methoxy]-3-methyloxolan-2-yl]ethanesulfonate |
| SMILES | COc1ccc(CO[C@@H]2[C@H](C)[C@@H](CCS(=O)(=O)Oc3ccc([N+](=O)[O-])cc3)O[C@H]2n2cnc3c(NC(=O)c4ccccc4)ncnc32)cc1 |
| InChI | InChI=1S/C33H32N6O9S/c1-21-27(16-17-49(43,44)48-26-14-10-24(11-15-26)39(41)42)47-33(29(21)46-18-22-8-12-25(45-2)13-9-22)38-20-36-28-30(34-19-35-31(28)38)37-32(40)23-6-4-3-5-7-23/h3-15,19-21,27,29,33H,16-18H2,1-2H3,(H,34,35,37,40)/t21-,27-,29-,33-/m1/s1 |
| InChIKey | APAIZHMTWBSMJL-MHKXMRMRSA-N |
| XLogP | 4.91 |
| TPSA | 186.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.72 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|