C27H38N6O4 — CID 20747754
N-[9-[5-[1-[di(propan-2-yl)amino]ethoxymethyl]-3-methoxy-4-methyloxolan-2-yl]purin-6-yl]benzamide (PubChem CID 20747754) has the molecular formula C27H38N6O4 and a molecular weight of 510.64 g/mol. Its IUPAC name is N-[9-[5-[1-[di(propan-2-yl)amino]ethoxymethyl]-3-methoxy-4-methyloxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[5-[1-[di(propan-2-yl)amino]ethoxymethyl]-3-methoxy-4-methyloxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 20747754 |
| Molecular Formula | C27H38N6O4 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | N-[9-[5-[1-[di(propan-2-yl)amino]ethoxymethyl]-3-methoxy-4-methyloxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COC1C(C)C(COC(C)N(C(C)C)C(C)C)OC1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C27H38N6O4/c1-16(2)33(17(3)4)19(6)36-13-21-18(5)23(35-7)27(37-21)32-15-30-22-24(28-14-29-25(22)32)31-26(34)20-11-9-8-10-12-20/h8-12,14-19,21,23,27H,13H2,1-7H3,(H,28,29,31,34) |
| InChIKey | BXJCPCDOTZKYJI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|