C26H22N6O7 — CID 166470250
N-[9-[(2R,3R,4R,5R)-5-[(1,3-dioxoisoindol-2-yl)oxymethyl]-4-hydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 166470250) has the molecular formula C26H22N6O7 and a molecular weight of 530.50 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-5-[(1,3-dioxoisoindol-2-yl)oxymethyl]-4-hydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-5-[(1,3-dioxoisoindol-2-yl)oxymethyl]-4-hydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 166470250 |
| Molecular Formula | C26H22N6O7 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-5-[(1,3-dioxoisoindol-2-yl)oxymethyl]-4-hydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CON2C(=O)c3ccccc3C2=O)O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C26H22N6O7/c1-37-20-19(33)17(11-38-32-24(35)15-9-5-6-10-16(15)25(32)36)39-26(20)31-13-29-18-21(27-12-28-22(18)31)30-23(34)14-7-3-2-4-8-14/h2-10,12-13,17,19-20,26,33H,11H2,1H3,(H,27,28,30,34)/t17-,19-,20-,26-/m1/s1 |
| InChIKey | TZZNXUCXAIWSBM-REMZYBCOSA-N |
| XLogP | 1.58 |
| TPSA | 158.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|