C39H38N6O5 — CID 158619840
N-[9-[(2R,3R,4R)-5-(aminomethyl)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-methyloxolan-2-yl]purin-6-yl]benzamide (PubChem CID 158619840) has the molecular formula C39H38N6O5 and a molecular weight of 670.77 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R)-5-(aminomethyl)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-methyloxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R)-5-(aminomethyl)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-methyloxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 158619840 |
| Molecular Formula | C39H38N6O5 |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | N-[9-[(2R,3R,4R)-5-(aminomethyl)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-methyloxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(O[C@@H]2[C@H](C)C(CN)O[C@H]2n2cnc3c(NC(=O)c4ccccc4)ncnc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H38N6O5/c1-25-32(22-40)49-38(45-24-43-33-35(41-23-42-36(33)45)44-37(46)26-10-6-4-7-11-26)34(25)50-39(27-12-8-5-9-13-27,28-14-18-30(47-2)19-15-28)29-16-20-31(48-3)21-17-29/h4-21,23-25,32,34,38H,22,40H2,1-3H3,(H,41,42,44,46)/t25-,32?,34-,38-/m1/s1 |
| InChIKey | ZTMMSUNLFCQIJF-OUTPYAPMSA-N |
| XLogP | 5.97 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|