C32H32FN5O3 — CID 170387594
9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one (PubChem CID 170387594) has the molecular formula C32H32FN5O3 and a molecular weight of 553.64 g/mol. Its IUPAC name is 9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one.
| Compound Name | 9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 170387594 |
| Molecular Formula | C32H32FN5O3 |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 9-[(2R,3S,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)nc32)[C@@H](F)[C@@H]1C |
| InChI | InChI=1S/C32H32FN5O3/c1-4-25-20(2)26(33)30(41-25)38-19-34-27-28(38)35-31(36-29(27)39)37-32(21-11-7-5-8-12-21,22-13-9-6-10-14-22)23-15-17-24(40-3)18-16-23/h5-20,25-26,30H,4H2,1-3H3,(H2,35,36,37,39)/t20-,25-,26+,30-/m1/s1 |
| InChIKey | IODNJIXVBLGGRR-SJEQQYOWSA-N |
| XLogP | 5.81 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|