C31H28F2IN5O4 — CID 136506729
9-[(2R,3R,4S,5R)-3,5-difluoro-4-hydroxy-5-(iodomethyl)-3-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one (PubChem CID 136506729) has the molecular formula C31H28F2IN5O4 and a molecular weight of 699.50 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,5-difluoro-4-hydroxy-5-(iodomethyl)-3-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4S,5R)-3,5-difluoro-4-hydroxy-5-(iodomethyl)-3-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 136506729 |
| Molecular Formula | C31H28F2IN5O4 |
| Molecular Weight | 699.50 g/mol |
| Exact Mass | 699.12 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,5-difluoro-4-hydroxy-5-(iodomethyl)-3-methyloxolan-2-yl]-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1H-purin-6-one |
| SMILES | COc1ccc(C(Nc2nc3c(ncn3[C@@H]3O[C@](F)(CI)[C@@H](O)[C@@]3(C)F)c(=O)[nH]2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28F2IN5O4/c1-29(32)26(41)30(33,17-34)43-27(29)39-18-35-23-24(39)36-28(37-25(23)40)38-31(19-9-5-3-6-10-19,20-11-7-4-8-12-20)21-13-15-22(42-2)16-14-21/h3-16,18,26-27,41H,17H2,1-2H3,(H2,36,37,38,40)/t26-,27+,29+,30+/m0/s1 |
| InChIKey | HOOCGTXWARBQPR-UGWFNHDDSA-N |
| XLogP | 5.25 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|