C31H30F2N6O4 — CID 134249624
(2S,3S,4R,5R)-5-[2-amino-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2,4-difluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 134249624) has the molecular formula C31H30F2N6O4 and a molecular weight of 588.62 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-amino-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2,4-difluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2S,3S,4R,5R)-5-[2-amino-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2,4-difluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 134249624 |
| Molecular Formula | C31H30F2N6O4 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-amino-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2,4-difluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | COc1ccc(C(Nc2nc(N)nc3c2ncn3[C@@H]2O[C@](F)(CO)[C@@H](O)[C@@]2(C)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30F2N6O4/c1-29(32)26(41)30(33,17-40)43-27(29)39-18-35-23-24(36-28(34)37-25(23)39)38-31(19-9-5-3-6-10-19,20-11-7-4-8-12-20)21-13-15-22(42-2)16-14-21/h3-16,18,26-27,40-41H,17H2,1-2H3,(H3,34,36,37,38)/t26-,27+,29+,30+/m0/s1 |
| InChIKey | RQLFGTYULUBIOE-UGWFNHDDSA-N |
| XLogP | 4.10 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|