C34H31F2N5O5 — CID 118019528
(2S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-2,4-difluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 118019528) has the molecular formula C34H31F2N5O5 and a molecular weight of 627.65 g/mol. Its IUPAC name is (2S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-2,4-difluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-2,4-difluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 118019528 |
| Molecular Formula | C34H31F2N5O5 |
| Molecular Weight | 627.65 g/mol |
| Exact Mass | 627.23 |
| IUPAC Name | (2S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-2,4-difluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | C#C[C@@]1(F)C(O)[C@@](F)(CO)O[C@H]1n1cnc2c(OCC)nc(NC(c3ccccc3)(c3ccccc3)c3ccc(OC)cc3)nc21 |
| InChI | InChI=1S/C34H31F2N5O5/c1-4-32(35)29(43)33(36,20-42)46-30(32)41-21-37-26-27(41)38-31(39-28(26)45-5-2)40-34(22-12-8-6-9-13-22,23-14-10-7-11-15-23)24-16-18-25(44-3)19-17-24/h1,6-19,21,29-30,42-43H,5,20H2,2-3H3,(H,38,39,40)/t29?,30-,32-,33-/m1/s1 |
| InChIKey | NRCRRGJTJPVXNY-AOIKVBCXSA-N |
| XLogP | 4.53 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|