C35H33F2N5O4 — CID 90251506
(2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-ethyl-4-ethynyl-2,4-difluorooxolan-3-ol (PubChem CID 90251506) has the molecular formula C35H33F2N5O4 and a molecular weight of 625.68 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-ethyl-4-ethynyl-2,4-difluorooxolan-3-ol.
| Compound Name | (2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-ethyl-4-ethynyl-2,4-difluorooxolan-3-ol |
|---|---|
| PubChem CID | 90251506 |
| Molecular Formula | C35H33F2N5O4 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-ethyl-4-ethynyl-2,4-difluorooxolan-3-ol |
| SMILES | C#C[C@]1(F)[C@H](n2cnc3c(OCC)nc(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)nc32)O[C@](F)(CC)[C@H]1O |
| InChI | InChI=1S/C35H33F2N5O4/c1-5-33(36)30(43)34(37,6-2)46-31(33)42-22-38-27-28(42)39-32(40-29(27)45-7-3)41-35(23-14-10-8-11-15-23,24-16-12-9-13-17-24)25-18-20-26(44-4)21-19-25/h1,8-22,30-31,43H,6-7H2,2-4H3,(H,39,40,41)/t30-,31+,33+,34+/m0/s1 |
| InChIKey | CVZIYBNZLYOWFD-WVBWOMQXSA-N |
| XLogP | 5.94 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|