C34H33N5O6 — CID 90247979
(2R,3R,4R,5R)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 90247979) has the molecular formula C34H33N5O6 and a molecular weight of 607.67 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 90247979 |
| Molecular Formula | C34H33N5O6 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | (2R,3R,4R,5R)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(OCC)nc(NC(c3ccccc3)(c3ccccc3)c3ccc(OC)cc3)nc21 |
| InChI | InChI=1S/C34H33N5O6/c1-4-33(42)28(41)26(20-40)45-31(33)39-21-35-27-29(39)36-32(37-30(27)44-5-2)38-34(22-12-8-6-9-13-22,23-14-10-7-11-15-23)24-16-18-25(43-3)19-17-24/h1,6-19,21,26,28,31,40-42H,5,20H2,2-3H3,(H,36,37,38)/t26-,28-,31-,33-/m1/s1 |
| InChIKey | KVIITBADEZJKMD-SGRBNEAFSA-N |
| XLogP | 3.25 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|