C35H33F2N5O6P+ — CID 118012835
[(2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-methyl-oxophosphanium (PubChem CID 118012835) has the molecular formula C35H33F2N5O6P+ and a molecular weight of 688.65 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-methyl-oxophosphanium.
| Compound Name | [(2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 118012835 |
| Molecular Formula | C35H33F2N5O6P+ |
| Molecular Weight | 688.65 g/mol |
| Exact Mass | 688.21 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-methyl-oxophosphanium |
| SMILES | C#C[C@]1(F)[C@H](n2cnc3c(OCC)nc(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)nc32)O[C@](F)(CO[P+](C)=O)[C@H]1O |
| InChI | InChI=1S/C35H33F2N5O6P/c1-5-33(36)30(43)34(37,21-47-49(4)44)48-31(33)42-22-38-27-28(42)39-32(40-29(27)46-6-2)41-35(23-13-9-7-10-14-23,24-15-11-8-12-16-24)25-17-19-26(45-3)20-18-25/h1,7-20,22,30-31,43H,6,21H2,2-4H3,(H,39,40,41)/q+1/t30-,31+,33+,34+/m0/s1 |
| InChIKey | LVWJEAIFXNTVAA-WVBWOMQXSA-N |
| XLogP | 5.92 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|