C20H20FN5O7P+ — CID 126554515
[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-phenoxyphosphanium (PubChem CID 126554515) has the molecular formula C20H20FN5O7P+ and a molecular weight of 492.38 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 126554515 |
| Molecular Formula | C20H20FN5O7P+ |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
| SMILES | C#C[C@]1(O)[C@H](n2cnc3c(OCC)nc(N)nc32)O[C@](F)(CO[P+](=O)Oc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C20H20FN5O7P/c1-3-19(28)16(27)20(21,10-31-34(29)33-12-8-6-5-7-9-12)32-17(19)26-11-23-13-14(26)24-18(22)25-15(13)30-4-2/h1,5-9,11,16-17,27-28H,4,10H2,2H3,(H2,22,24,25)/q+1/t16-,17+,19+,20+/m0/s1 |
| InChIKey | YDDQKNBSBBLMLW-ONCXSQPRSA-N |
| XLogP | 1.48 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|