C21H23N5O5P+ — CID 138721937
[(1S,2S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-1-ethynyl-2-hydroxycyclopentyl]methoxy-oxo-phenoxyphosphanium (PubChem CID 138721937) has the molecular formula C21H23N5O5P+ and a molecular weight of 456.42 g/mol. Its IUPAC name is [(1S,2S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-1-ethynyl-2-hydroxycyclopentyl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [(1S,2S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-1-ethynyl-2-hydroxycyclopentyl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 138721937 |
| Molecular Formula | C21H23N5O5P+ |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [(1S,2S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-1-ethynyl-2-hydroxycyclopentyl]methoxy-oxo-phenoxyphosphanium |
| SMILES | C#C[C@]1(CO[P+](=O)Oc2ccccc2)C[C@@H](n2cnc3c(OCC)nc(N)nc32)C[C@@H]1O |
| InChI | InChI=1S/C21H23N5O5P/c1-3-21(12-30-32(28)31-15-8-6-5-7-9-15)11-14(10-16(21)27)26-13-23-17-18(26)24-20(22)25-19(17)29-4-2/h1,5-9,13-14,16,27H,4,10-12H2,2H3,(H2,22,24,25)/q+1/t14-,16-,21+/m0/s1 |
| InChIKey | DTXZWWSEGQTRMB-WDUKFBBWSA-N |
| XLogP | 2.88 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|