C24H29N6O7P — CID 138678496
(2S)-2-[[[(1R,2R,4S)-4-(2-amino-6-ethoxypurin-9-yl)-1-ethynyl-2-hydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 138678496) has the molecular formula C24H29N6O7P and a molecular weight of 544.51 g/mol. Its IUPAC name is (2S)-2-[[[(1R,2R,4S)-4-(2-amino-6-ethoxypurin-9-yl)-1-ethynyl-2-hydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | (2S)-2-[[[(1R,2R,4S)-4-(2-amino-6-ethoxypurin-9-yl)-1-ethynyl-2-hydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 138678496 |
| Molecular Formula | C24H29N6O7P |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | (2S)-2-[[[(1R,2R,4S)-4-(2-amino-6-ethoxypurin-9-yl)-1-ethynyl-2-hydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | C#C[C@@]1(CO[P@@](=O)(N[C@@H](C)C(=O)O)Oc2ccccc2)C[C@H](n2cnc3c(OCC)nc(N)nc32)C[C@H]1O |
| InChI | InChI=1S/C24H29N6O7P/c1-4-24(13-36-38(34,29-15(3)22(32)33)37-17-9-7-6-8-10-17)12-16(11-18(24)31)30-14-26-19-20(30)27-23(25)28-21(19)35-5-2/h1,6-10,14-16,18,31H,5,11-13H2,2-3H3,(H,29,34)(H,32,33)(H2,25,27,28)/t15-,16+,18+,24-,38-/m0/s1 |
| InChIKey | RAQPOBAXVHIEAW-LWRTWXKQSA-N |
| XLogP | 2.39 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|