C13H14ClN5O2 — CID 138678526
(1S,2S,4R)-4-(6-amino-2-chloropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)cyclopentan-1-ol (PubChem CID 138678526) has the molecular formula C13H14ClN5O2 and a molecular weight of 307.74 g/mol. Its IUPAC name is (1S,2S,4R)-4-(6-amino-2-chloropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)cyclopentan-1-ol.
| Compound Name | (1S,2S,4R)-4-(6-amino-2-chloropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 138678526 |
| Molecular Formula | C13H14ClN5O2 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (1S,2S,4R)-4-(6-amino-2-chloropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)cyclopentan-1-ol |
| SMILES | C#C[C@]1(CO)C[C@@H](n2cnc3c(N)nc(Cl)nc32)C[C@@H]1O |
| InChI | InChI=1S/C13H14ClN5O2/c1-2-13(5-20)4-7(3-8(13)21)19-6-16-9-10(15)17-12(14)18-11(9)19/h1,6-8,20-21H,3-5H2,(H2,15,17,18)/t7-,8-,13+/m0/s1 |
| InChIKey | PDIXLVQZOFDXLW-UVPNAGLESA-N |
| XLogP | 0.37 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|