C10H14N6O2 — CID 73050804
trans-(1R,2R)-4-(2,6-diaminopurin-9-yl)cyclopentane-1,2-diol (PubChem CID 73050804) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is trans-(1R,2R)-4-(2,6-diaminopurin-9-yl)cyclopentane-1,2-diol.
| Compound Name | trans-(1R,2R)-4-(2,6-diaminopurin-9-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 73050804 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | trans-(1R,2R)-4-(2,6-diaminopurin-9-yl)cyclopentane-1,2-diol |
| SMILES | Nc1nc(N)c2ncn(C3C[C@@H](O)[C@H](O)C3)c2n1 |
| InChI | InChI=1S/C10H14N6O2/c11-8-7-9(15-10(12)14-8)16(3-13-7)4-1-5(17)6(18)2-4/h3-6,17-18H,1-2H2,(H4,11,12,14,15)/t5-,6-/m1/s1 |
| InChIKey | UVPSXHQATSNKHM-PHDIDXHHSA-N |
| XLogP | -0.95 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |