C10H12N6O — CID 57488425
(1S,4R)-4-(2,6-diaminopurin-9-yl)cyclopent-2-en-1-ol (PubChem CID 57488425) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is (1S,4R)-4-(2,6-diaminopurin-9-yl)cyclopent-2-en-1-ol.
| Compound Name | (1S,4R)-4-(2,6-diaminopurin-9-yl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 57488425 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (1S,4R)-4-(2,6-diaminopurin-9-yl)cyclopent-2-en-1-ol |
| SMILES | Nc1nc(N)c2ncn([C@H]3C=C[C@@H](O)C3)c2n1 |
| InChI | InChI=1S/C10H12N6O/c11-8-7-9(15-10(12)14-8)16(4-13-7)5-1-2-6(17)3-5/h1-2,4-6,17H,3H2,(H4,11,12,14,15)/t5-,6+/m0/s1 |
| InChIKey | BXPNKZFLTBFGKY-NTSWFWBYSA-N |
| XLogP | -0.15 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|