C11H15N6O5P — CID 25152136
[(E)-2-[(2S,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-hydroxyoxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 25152136) has the molecular formula C11H15N6O5P and a molecular weight of 342.25 g/mol. Its IUPAC name is [(E)-2-[(2S,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-hydroxyoxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(2S,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-hydroxyoxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 25152136 |
| Molecular Formula | C11H15N6O5P |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [(E)-2-[(2S,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-hydroxyoxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | Nc1nc(N)c2ncn([C@@H]3O[C@H](/C=C/P(=O)(O)O)C[C@H]3O)c2n1 |
| InChI | InChI=1S/C11H15N6O5P/c12-8-7-9(16-11(13)15-8)17(4-14-7)10-6(18)3-5(22-10)1-2-23(19,20)21/h1-2,4-6,10,18H,3H2,(H2,19,20,21)(H4,12,13,15,16)/b2-1+/t5-,6-,10-/m1/s1 |
| InChIKey | AVQBHLFQIJMJKN-UIZSYMRYSA-N |
| XLogP | -0.67 |
| TPSA | 182.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|