C11H14N5O7P — CID 171447630
[(Z)-2-[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 171447630) has the molecular formula C11H14N5O7P and a molecular weight of 359.24 g/mol. Its IUPAC name is [(Z)-2-[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(Z)-2-[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 171447630 |
| Molecular Formula | C11H14N5O7P |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [(Z)-2-[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](/C=C\P(=O)(O)O)[C@H](O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H14N5O7P/c12-11-14-8-5(9(19)15-11)13-3-16(8)10-7(18)6(17)4(23-10)1-2-24(20,21)22/h1-4,6-7,10,17-18H,(H2,20,21,22)(H3,12,14,15,19)/b2-1-/t4-,6+,7?,10-/m1/s1 |
| InChIKey | KKXFEJONVZGCSA-YYYIFGAKSA-N |
| XLogP | -1.99 |
| TPSA | 196.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|