C9H10N5O8P-2 — CID 140785231
[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl] phosphate (PubChem CID 140785231) has the molecular formula C9H10N5O8P-2 and a molecular weight of 347.18 g/mol. Its IUPAC name is [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl] phosphate.
| Compound Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl] phosphate |
|---|---|
| PubChem CID | 140785231 |
| Molecular Formula | C9H10N5O8P-2 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl] phosphate |
| SMILES | Nc1nc2c(ncn2C2OC(OP(=O)([O-])[O-])C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N5O8P/c10-9-12-5-2(6(17)13-9)11-1-14(5)7-3(15)4(16)8(21-7)22-23(18,19)20/h1,3-4,7-8,15-16H,(H2,18,19,20)(H3,10,12,13,17)/p-2 |
| InChIKey | CPAANHJLNITOLG-UHFFFAOYSA-L |
| XLogP | -3.88 |
| TPSA | 211.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|