C10H16N5Na2O15P3 — CID 160552839
disodium;2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;[hydroxy(phosphonooxy)phosphoryl] phosphate (PubChem CID 160552839) has the molecular formula C10H16N5Na2O15P3 and a molecular weight of 585.16 g/mol. Its IUPAC name is disodium;2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;[hydroxy(phosphonooxy)phosphoryl] phosphate.
| Compound Name | disodium;2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;[hydroxy(phosphonooxy)phosphoryl] phosphate |
|---|---|
| PubChem CID | 160552839 |
| Molecular Formula | C10H16N5Na2O15P3 |
| Molecular Weight | 585.16 g/mol |
| Exact Mass | 584.97 |
| IUPAC Name | disodium;2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;[hydroxy(phosphonooxy)phosphoryl] phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1.O=P([O-])([O-])OP(=O)(O)OP(=O)(O)O.[Na+].[Na+] |
| InChI | InChI=1S/C10H13N5O5.2Na.H5O10P3/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9;;;1-11(2,3)9-13(7,8)10-12(4,5)6/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19);;;(H,7,8)(H2,1,2,3)(H2,4,5,6)/q;2*+1;/p-2/t3-,5-,6-,9-;;;/m1.../s1 |
| InChIKey | QYHKKDARKNSMCD-CYCLDIHTSA-L |
| XLogP | -10.64 |
| TPSA | 335.99 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.16 |
| LogP ≤ 5 | -10.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|