C10H16N5O12P2S+ — CID 172679999
CID 172679999 (PubChem CID 172679999) has the molecular formula C10H16N5O12P2S+ and a molecular weight of 492.28 g/mol.
| Compound Name | CID 172679999 |
|---|---|
| PubChem CID | 172679999 |
| Molecular Formula | C10H16N5O12P2S+ |
| Molecular Weight | 492.28 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | — |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](C(O)O[S+]=P(O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N5O12P2S/c11-10-13-6-2(7(18)14-10)12-1-15(6)8-4(17)3(16)5(25-8)9(19)26-30-29(23,24)27-28(20,21)22/h1,3-5,8-9,16-17,19H,(H6-,11,13,14,18,20,21,22,23,24)/p+1/t3-,4+,5-,8+,9?/m0/s1 |
| InChIKey | NIKPKMDQZOGDQQ-JXNOSOHOSA-O |
| XLogP | -3.57 |
| TPSA | 275.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.28 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|