C15H26N5O19P3 — CID 174473010
[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate;2,3,4,5-tetrahydroxypentanal (PubChem CID 174473010) has the molecular formula C15H26N5O19P3 and a molecular weight of 673.31 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate;2,3,4,5-tetrahydroxypentanal.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate;2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 174473010 |
| Molecular Formula | C15H26N5O19P3 |
| Molecular Weight | 673.31 g/mol |
| Exact Mass | 673.04 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate;2,3,4,5-tetrahydroxypentanal |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1.O=CC(O)C(O)C(O)CO |
| InChI | InChI=1S/C10H16N5O14P3.C5H10O5/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21;6-1-3(8)5(10)4(9)2-7/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18);1,3-5,7-10H,2H2/t3-,5-,6-,9-;/m1./s1 |
| InChIKey | DDGVVJGUFKRFOR-GWTDSMLYSA-N |
| XLogP | -5.08 |
| TPSA | 397.09 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.31 |
| LogP ≤ 5 | -5.08 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|