C16H26N5O13P — CID 159614061
[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal (PubChem CID 159614061) has the molecular formula C16H26N5O13P and a molecular weight of 527.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 159614061 |
| Molecular Formula | C16H26N5O13P |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C=O.Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N5O8P.C6H12O5/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21;1-3(8)5(10)6(11)4(9)2-7/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18);2-6,8-11H,1H3/t3-,5-,6-,9-;3-,4+,5+,6-/m10/s1 |
| InChIKey | MNBGSIUWGSZUCI-DKEFOWNISA-N |
| XLogP | -4.92 |
| TPSA | 304.03 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | -4.92 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|