C10H14N6O3 — CID 13160027
2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 13160027) has the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | 2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 13160027 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1nc(N)c2ncn(C3OC(CO)CC3O)c2n1 |
| InChI | InChI=1S/C10H14N6O3/c11-7-6-8(15-10(12)14-7)16(3-13-6)9-5(18)1-4(2-17)19-9/h3-5,9,17-18H,1-2H2,(H4,11,12,14,15) |
| InChIKey | ALUXLVWCGFWJMC-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |