C11H14ClN5O4 — CID 67669536
(2R,3R,5S)-2-[6-amino-2-(chloromethoxy)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 67669536) has the molecular formula C11H14ClN5O4 and a molecular weight of 315.72 g/mol. Its IUPAC name is (2R,3R,5S)-2-[6-amino-2-(chloromethoxy)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5S)-2-[6-amino-2-(chloromethoxy)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 67669536 |
| Molecular Formula | C11H14ClN5O4 |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (2R,3R,5S)-2-[6-amino-2-(chloromethoxy)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1nc(OCCl)nc2c1ncn2[C@@H]1O[C@H](CO)C[C@H]1O |
| InChI | InChI=1S/C11H14ClN5O4/c12-3-20-11-15-8(13)7-9(16-11)17(4-14-7)10-6(19)1-5(2-18)21-10/h4-6,10,18-19H,1-3H2,(H2,13,15,16)/t5-,6+,10+/m0/s1 |
| InChIKey | FUHFRCVRANSRCL-BAJZRUMYSA-N |
| XLogP | -0.38 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|