C12H19N7O — CID 110129701
(1R,2R,6R)-2-(2,6-diaminopurin-9-yl)-6-(methylamino)cyclohexan-1-ol (PubChem CID 110129701) has the molecular formula C12H19N7O and a molecular weight of 277.33 g/mol. Its IUPAC name is (1R,2R,6R)-2-(2,6-diaminopurin-9-yl)-6-(methylamino)cyclohexan-1-ol.
| Compound Name | (1R,2R,6R)-2-(2,6-diaminopurin-9-yl)-6-(methylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 110129701 |
| Molecular Formula | C12H19N7O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (1R,2R,6R)-2-(2,6-diaminopurin-9-yl)-6-(methylamino)cyclohexan-1-ol |
| SMILES | CN[C@@H]1CCC[C@@H](n2cnc3c(N)nc(N)nc32)[C@@H]1O |
| InChI | InChI=1S/C12H19N7O/c1-15-6-3-2-4-7(9(6)20)19-5-16-8-10(13)17-12(14)18-11(8)19/h5-7,9,15,20H,2-4H2,1H3,(H4,13,14,17,18)/t6-,7-,9-/m1/s1 |
| InChIKey | FZSPKXAKEXYVOF-ZXFLCMHBSA-N |
| XLogP | -0.34 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |