C12H18N6O — CID 102426371
[(1S,2R)-2-[(2,6-diaminopurin-9-yl)methyl]cyclopentyl]methanol (PubChem CID 102426371) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is [(1S,2R)-2-[(2,6-diaminopurin-9-yl)methyl]cyclopentyl]methanol.
| Compound Name | [(1S,2R)-2-[(2,6-diaminopurin-9-yl)methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 102426371 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | [(1S,2R)-2-[(2,6-diaminopurin-9-yl)methyl]cyclopentyl]methanol |
| SMILES | Nc1nc(N)c2ncn(C[C@@H]3CCC[C@@H]3CO)c2n1 |
| InChI | InChI=1S/C12H18N6O/c13-10-9-11(17-12(14)16-10)18(6-15-9)4-7-2-1-3-8(7)5-19/h6-8,19H,1-5H2,(H4,13,14,16,17)/t7-,8+/m0/s1 |
| InChIKey | JTXMMDUNZFYBTK-JGVFFNPUSA-N |
| XLogP | 0.40 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |