C13H19N5O2 — CID 135625260
2-amino-9-[[(2S)-2-(hydroxymethyl)cyclohexyl]methyl]-1H-purin-6-one (PubChem CID 135625260) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-amino-9-[[(2S)-2-(hydroxymethyl)cyclohexyl]methyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[[(2S)-2-(hydroxymethyl)cyclohexyl]methyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135625260 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-amino-9-[[(2S)-2-(hydroxymethyl)cyclohexyl]methyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CC2CCCC[C@@H]2CO)c(=O)[nH]1 |
| InChI | InChI=1S/C13H19N5O2/c14-13-16-11-10(12(20)17-13)15-7-18(11)5-8-3-1-2-4-9(8)6-19/h7-9,19H,1-6H2,(H3,14,16,17,20)/t8?,9-/m1/s1 |
| InChIKey | NNUZPTLISFKQLP-YGPZHTELSA-N |
| XLogP | 0.50 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |