C11H13N5O2 — CID 136771347
2-amino-9-(3,4-dihydro-2H-pyran-2-ylmethyl)-1H-purin-6-one (PubChem CID 136771347) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-amino-9-(3,4-dihydro-2H-pyran-2-ylmethyl)-1H-purin-6-one.
| Compound Name | 2-amino-9-(3,4-dihydro-2H-pyran-2-ylmethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 136771347 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-amino-9-(3,4-dihydro-2H-pyran-2-ylmethyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CC2CCC=CO2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H13N5O2/c12-11-14-9-8(10(17)15-11)13-6-16(9)5-7-3-1-2-4-18-7/h2,4,6-7H,1,3,5H2,(H3,12,14,15,17) |
| InChIKey | HWRCDODLNBAZGY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |