C10H19N5O3 — CID 153365638
2-amino-9-(2-hydroxyethyl)-1H-purin-6-one;ethane;methanol (PubChem CID 153365638) has the molecular formula C10H19N5O3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethyl)-1H-purin-6-one;ethane;methanol.
| Compound Name | 2-amino-9-(2-hydroxyethyl)-1H-purin-6-one;ethane;methanol |
|---|---|
| PubChem CID | 153365638 |
| Molecular Formula | C10H19N5O3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-amino-9-(2-hydroxyethyl)-1H-purin-6-one;ethane;methanol |
| SMILES | CC.CO.Nc1nc2c(ncn2CCO)c(=O)[nH]1 |
| InChI | InChI=1S/C7H9N5O2.C2H6.CH4O/c8-7-10-5-4(6(14)11-7)9-3-12(5)1-2-13;2*1-2/h3,13H,1-2H2,(H3,8,10,11,14);1-2H3;2H,1H3 |
| InChIKey | INBGDXWLHLDHFF-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |