C10H15N5O3 — CID 136756749
2-amino-9-[(2R,3R)-3,4-dihydroxy-2-methylbutyl]-1H-purin-6-one (PubChem CID 136756749) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R)-3,4-dihydroxy-2-methylbutyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R)-3,4-dihydroxy-2-methylbutyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136756749 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-amino-9-[(2R,3R)-3,4-dihydroxy-2-methylbutyl]-1H-purin-6-one |
| SMILES | C[C@H](Cn1cnc2c(=O)[nH]c(N)nc21)[C@@H](O)CO |
| InChI | InChI=1S/C10H15N5O3/c1-5(6(17)3-16)2-15-4-12-7-8(15)13-10(11)14-9(7)18/h4-6,16-17H,2-3H2,1H3,(H3,11,13,14,18)/t5-,6+/m1/s1 |
| InChIKey | QMIMQACFJZIUKV-RITPCOANSA-N |
| XLogP | -1.31 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |