C11H17N5O5 — CID 136502764
2-amino-9-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]-1H-purin-6-one (PubChem CID 136502764) has the molecular formula C11H17N5O5 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-amino-9-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136502764 |
| Molecular Formula | C11H17N5O5 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-amino-9-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]-1H-purin-6-one |
| SMILES | CC(O[C@H](CO)C(O)CO)n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H17N5O5/c1-5(21-7(3-18)6(19)2-17)16-4-13-8-9(16)14-11(12)15-10(8)20/h4-7,17-19H,2-3H2,1H3,(H3,12,14,15,20)/t5?,6?,7-/m1/s1 |
| InChIKey | RZKLTDUDGXJZTA-KPGICGJXSA-N |
| XLogP | -2.05 |
| TPSA | 159.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |