C8H11N5O2 — CID 135996340
2-amino-9-(1-methoxyethyl)-1H-purin-6-one (PubChem CID 135996340) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-amino-9-(1-methoxyethyl)-1H-purin-6-one.
| Compound Name | 2-amino-9-(1-methoxyethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135996340 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-amino-9-(1-methoxyethyl)-1H-purin-6-one |
| SMILES | COC(C)n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C8H11N5O2/c1-4(15-2)13-3-10-5-6(13)11-8(9)12-7(5)14/h3-4H,1-2H3,(H3,9,11,12,14) |
| InChIKey | IQJOZJVGEOFSPD-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |