C12H19N5O3S — CID 142535864
2-amino-9-[(1R)-1-[(2S)-1-hydroxy-5-sulfanylpentan-2-yl]oxyethyl]-1H-purin-6-one (PubChem CID 142535864) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-amino-9-[(1R)-1-[(2S)-1-hydroxy-5-sulfanylpentan-2-yl]oxyethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1R)-1-[(2S)-1-hydroxy-5-sulfanylpentan-2-yl]oxyethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 142535864 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-amino-9-[(1R)-1-[(2S)-1-hydroxy-5-sulfanylpentan-2-yl]oxyethyl]-1H-purin-6-one |
| SMILES | C[C@@H](O[C@H](CO)CCCS)n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C12H19N5O3S/c1-7(20-8(5-18)3-2-4-21)17-6-14-9-10(17)15-12(13)16-11(9)19/h6-8,18,21H,2-5H2,1H3,(H3,13,15,16,19)/t7-,8+/m1/s1 |
| InChIKey | ADFCGIZAROONGD-SFYZADRCSA-N |
| XLogP | 0.31 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|