C19H33N5O — CID 137034322
2-amino-9-tetradecan-7-yl-1H-purin-6-one (PubChem CID 137034322) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is 2-amino-9-tetradecan-7-yl-1H-purin-6-one.
| Compound Name | 2-amino-9-tetradecan-7-yl-1H-purin-6-one |
|---|---|
| PubChem CID | 137034322 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | 2-amino-9-tetradecan-7-yl-1H-purin-6-one |
| SMILES | CCCCCCCC(CCCCCC)n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C19H33N5O/c1-3-5-7-9-11-13-15(12-10-8-6-4-2)24-14-21-16-17(24)22-19(20)23-18(16)25/h14-15H,3-13H2,1-2H3,(H3,20,22,23,25) |
| InChIKey | MVXIVYVJEYISMU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|