C28H47N5O5 — CID 136880185
[3-(2-amino-6-oxo-1H-purin-9-yl)-2-decanoyloxypropyl] decanoate (PubChem CID 136880185) has the molecular formula C28H47N5O5 and a molecular weight of 533.71 g/mol. Its IUPAC name is [3-(2-amino-6-oxo-1H-purin-9-yl)-2-decanoyloxypropyl] decanoate.
| Compound Name | [3-(2-amino-6-oxo-1H-purin-9-yl)-2-decanoyloxypropyl] decanoate |
|---|---|
| PubChem CID | 136880185 |
| Molecular Formula | C28H47N5O5 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.36 |
| IUPAC Name | [3-(2-amino-6-oxo-1H-purin-9-yl)-2-decanoyloxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(Cn1cnc2c(=O)[nH]c(N)nc21)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C28H47N5O5/c1-3-5-7-9-11-13-15-17-23(34)37-20-22(38-24(35)18-16-14-12-10-8-6-4-2)19-33-21-30-25-26(33)31-28(29)32-27(25)36/h21-22H,3-20H2,1-2H3,(H3,29,31,32,36) |
| InChIKey | HVFLZQWNXVENAO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|