C33H56N6O5 — CID 149431782
[(2R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]butyl] octadec-9-enoate (PubChem CID 149431782) has the molecular formula C33H56N6O5 and a molecular weight of 616.85 g/mol. Its IUPAC name is [(2R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]butyl] octadec-9-enoate.
| Compound Name | [(2R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]butyl] octadec-9-enoate |
|---|---|
| PubChem CID | 149431782 |
| Molecular Formula | C33H56N6O5 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.43 |
| IUPAC Name | [(2R)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]butyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC[C@H](CCOC(=O)[C@@H](N)C(C)C)Cn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C33H56N6O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-27(40)44-23-26(20-21-43-32(42)28(34)25(2)3)22-39-24-36-29-30(39)37-33(35)38-31(29)41/h11-12,24-26,28H,4-10,13-23,34H2,1-3H3,(H3,35,37,38,41)/t26-,28+/m1/s1 |
| InChIKey | VOJAEAXUDDNHIO-IAPPQJPRSA-N |
| XLogP | 5.82 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|