C23H38N6O4 — CID 54426242
[(3R)-3-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]-4-(2-aminopurin-9-yl)butyl] octanoate (PubChem CID 54426242) has the molecular formula C23H38N6O4 and a molecular weight of 462.60 g/mol. Its IUPAC name is [(3R)-3-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]-4-(2-aminopurin-9-yl)butyl] octanoate.
| Compound Name | [(3R)-3-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]-4-(2-aminopurin-9-yl)butyl] octanoate |
|---|---|
| PubChem CID | 54426242 |
| Molecular Formula | C23H38N6O4 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | [(3R)-3-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]-4-(2-aminopurin-9-yl)butyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC[C@@H](COC(=O)[C@@H](N)C(C)C)Cn1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C23H38N6O4/c1-4-5-6-7-8-9-19(30)32-11-10-17(14-33-22(31)20(24)16(2)3)13-29-15-27-18-12-26-23(25)28-21(18)29/h12,15-17,20H,4-11,13-14,24H2,1-3H3,(H2,25,26,28)/t17-,20+/m1/s1 |
| InChIKey | WEGSDTZMPJSGHN-XLIONFOSSA-N |
| XLogP | 2.85 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|