C19H30N6O4 — CID 54018257
[(3R)-3-[(2-aminopurin-9-yl)methyl]-4-butanoyloxybutyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 54018257) has the molecular formula C19H30N6O4 and a molecular weight of 406.49 g/mol. Its IUPAC name is [(3R)-3-[(2-aminopurin-9-yl)methyl]-4-butanoyloxybutyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(3R)-3-[(2-aminopurin-9-yl)methyl]-4-butanoyloxybutyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 54018257 |
| Molecular Formula | C19H30N6O4 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [(3R)-3-[(2-aminopurin-9-yl)methyl]-4-butanoyloxybutyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CCCC(=O)OC[C@H](CCOC(=O)[C@@H](N)C(C)C)Cn1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C19H30N6O4/c1-4-5-15(26)29-10-13(6-7-28-18(27)16(20)12(2)3)9-25-11-23-14-8-22-19(21)24-17(14)25/h8,11-13,16H,4-7,9-10,20H2,1-3H3,(H2,21,22,24)/t13-,16+/m1/s1 |
| InChIKey | KXCNUMPXHMIVOF-CJNGLKHVSA-N |
| XLogP | 1.28 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |