C31H52N6O4 — CID 66776079
[3-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]-4-(2-aminopurin-9-yl)butyl] hexadec-9-enoate (PubChem CID 66776079) has the molecular formula C31H52N6O4 and a molecular weight of 572.80 g/mol. Its IUPAC name is [3-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]-4-(2-aminopurin-9-yl)butyl] hexadec-9-enoate.
| Compound Name | [3-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]-4-(2-aminopurin-9-yl)butyl] hexadec-9-enoate |
|---|---|
| PubChem CID | 66776079 |
| Molecular Formula | C31H52N6O4 |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | [3-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]-4-(2-aminopurin-9-yl)butyl] hexadec-9-enoate |
| SMILES | CCCCCCC=CCCCCCCCC(=O)OCCC(COC(=O)[C@@H](N)C(C)C)Cn1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C31H52N6O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-27(38)40-19-18-25(22-41-30(39)28(32)24(2)3)21-37-23-35-26-20-34-31(33)36-29(26)37/h9-10,20,23-25,28H,4-8,11-19,21-22,32H2,1-3H3,(H2,33,34,36)/t25?,28-/m0/s1 |
| InChIKey | KSIZLMOJQHIYKF-NMXAJACMSA-N |
| XLogP | 5.74 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|