C22H36N6O4 — CID 66776326
[3-[(2-aminopurin-9-yl)methyl]-4-hexanoyloxybutyl] (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 66776326) has the molecular formula C22H36N6O4 and a molecular weight of 448.57 g/mol. Its IUPAC name is [3-[(2-aminopurin-9-yl)methyl]-4-hexanoyloxybutyl] (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | [3-[(2-aminopurin-9-yl)methyl]-4-hexanoyloxybutyl] (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 66776326 |
| Molecular Formula | C22H36N6O4 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | [3-[(2-aminopurin-9-yl)methyl]-4-hexanoyloxybutyl] (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CCCCCC(=O)OCC(CCOC(=O)[C@@H](N)[C@@H](C)CC)Cn1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C22H36N6O4/c1-4-6-7-8-18(29)32-13-16(9-10-31-21(30)19(23)15(3)5-2)12-28-14-26-17-11-25-22(24)27-20(17)28/h11,14-16,19H,4-10,12-13,23H2,1-3H3,(H2,24,25,27)/t15-,16?,19-/m0/s1 |
| InChIKey | PKYRFFYTQPBUGV-QLYZIHHJSA-N |
| XLogP | 2.45 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|