C32H54N6O4 — CID 66776264
[4-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-2-[(2-aminopurin-9-yl)methyl]butyl] hexadec-9-enoate (PubChem CID 66776264) has the molecular formula C32H54N6O4 and a molecular weight of 586.82 g/mol. Its IUPAC name is [4-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-2-[(2-aminopurin-9-yl)methyl]butyl] hexadec-9-enoate.
| Compound Name | [4-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-2-[(2-aminopurin-9-yl)methyl]butyl] hexadec-9-enoate |
|---|---|
| PubChem CID | 66776264 |
| Molecular Formula | C32H54N6O4 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.42 |
| IUPAC Name | [4-[(2S,3S)-2-amino-3-methylpentanoyl]oxy-2-[(2-aminopurin-9-yl)methyl]butyl] hexadec-9-enoate |
| SMILES | CCCCCCC=CCCCCCCCC(=O)OCC(CCOC(=O)[C@@H](N)[C@@H](C)CC)Cn1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C32H54N6O4/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-28(39)42-23-26(19-20-41-31(40)29(33)25(3)5-2)22-38-24-36-27-21-35-32(34)37-30(27)38/h10-11,21,24-26,29H,4-9,12-20,22-23,33H2,1-3H3,(H2,34,35,37)/t25-,26?,29-/m0/s1 |
| InChIKey | QIVCVTHSSYDFPC-HCRCYYOUSA-N |
| XLogP | 6.13 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|