C26H45N5NaO5 — CID 135536950
CID 135536950 (PubChem CID 135536950) has the molecular formula C26H45N5NaO5 and a molecular weight of 530.67 g/mol.
| Compound Name | CID 135536950 |
|---|---|
| PubChem CID | 135536950 |
| Molecular Formula | C26H45N5NaO5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | — |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.Nc1nc2c(ncn2COCCO)c(=O)[nH]1.[Na] |
| InChI | InChI=1S/C18H34O2.C8H11N5O3.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14;/h9-10H,2-8,11-17H2,1H3,(H,19,20);3,14H,1-2,4H2,(H3,9,11,12,15);/b10-9-;; |
| InChIKey | MPTRBSWNSOIYKH-XXAVUKJNSA-N |
| XLogP | 4.40 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|