C9H13Li4N5O9P2 — CID 173301328
tetralithium;2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;dioxido-oxo-(phosphonatomethyl)-λ5-phosphane (PubChem CID 173301328) has the molecular formula C9H13Li4N5O9P2 and a molecular weight of 424.94 g/mol. Its IUPAC name is tetralithium;2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;dioxido-oxo-(phosphonatomethyl)-λ5-phosphane.
| Compound Name | tetralithium;2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;dioxido-oxo-(phosphonatomethyl)-λ5-phosphane |
|---|---|
| PubChem CID | 173301328 |
| Molecular Formula | C9H13Li4N5O9P2 |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | tetralithium;2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;dioxido-oxo-(phosphonatomethyl)-λ5-phosphane |
| SMILES | Nc1nc2c(ncn2COCCO)c(=O)[nH]1.O=P([O-])([O-])CP(=O)([O-])[O-].[Li+].[Li+].[Li+].[Li+] |
| InChI | InChI=1S/C8H11N5O3.CH6O6P2.4Li/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14;2-8(3,4)1-9(5,6)7;;;;/h3,14H,1-2,4H2,(H3,9,11,12,15);1H2,(H2,2,3,4)(H2,5,6,7);;;;/q;;4*+1/p-4 |
| InChIKey | BKMLYJKYFVMITQ-UHFFFAOYSA-J |
| XLogP | -16.54 |
| TPSA | 245.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | -16.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|